C21H14N2O4 — CID 17385733
3-(1,3-dioxoisoindol-2-yl)-N-(2-hydroxyphenyl)benzamide (PubChem CID 17385733) has the molecular formula C21H14N2O4 and a molecular weight of 358.35 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-(2-hydroxyphenyl)benzamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-(2-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 17385733 |
| Molecular Formula | C21H14N2O4 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-(2-hydroxyphenyl)benzamide |
| SMILES | O=C(Nc1ccccc1O)c1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C21H14N2O4/c24-18-11-4-3-10-17(18)22-19(25)13-6-5-7-14(12-13)23-20(26)15-8-1-2-9-16(15)21(23)27/h1-12,24H,(H,22,25) |
| InChIKey | IDEZYDVMEZINTL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|