C22H12N2O6 — CID 628572
2,6-bis(2-hydroxyphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 628572) has the molecular formula C22H12N2O6 and a molecular weight of 400.35 g/mol. Its IUPAC name is 2,6-bis(2-hydroxyphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis(2-hydroxyphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 628572 |
| Molecular Formula | C22H12N2O6 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 2,6-bis(2-hydroxyphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | O=c1c2cc3c(=O)n(-c4ccccc4O)c(=O)c3cc2c(=O)n1-c1ccccc1O |
| InChI | InChI=1S/C22H12N2O6/c25-17-7-3-1-5-15(17)23-19(27)11-9-13-14(10-12(11)20(23)28)22(30)24(21(13)29)16-6-2-4-8-18(16)26/h1-10,25-26H |
| InChIKey | WYKSZSGFWPSFIS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |