C23H13N3O6 — CID 2867309
2-(1,3-dioxoisoindol-2-yl)-N-(4-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 2867309) has the molecular formula C23H13N3O6 and a molecular weight of 427.37 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(4-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(4-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 2867309 |
| Molecular Formula | C23H13N3O6 |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(4-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)c1ccc2c(c1)C(=O)N(N1C(=O)c3ccccc3C1=O)C2=O |
| InChI | InChI=1S/C23H13N3O6/c27-14-8-6-13(7-9-14)24-19(28)12-5-10-17-18(11-12)23(32)26(22(17)31)25-20(29)15-3-1-2-4-16(15)21(25)30/h1-11,27H,(H,24,28) |
| InChIKey | BUIPZORSUGMAAU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|