C17H19N5O3 — CID 17386398
N-[(E)-[4-(2-methoxy-5-methylanilino)-4-oxobutan-2-ylidene]amino]pyrazine-2-carboxamide (PubChem CID 17386398) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is N-[(E)-[4-(2-methoxy-5-methylanilino)-4-oxobutan-2-ylidene]amino]pyrazine-2-carboxamide.
| Compound Name | N-[(E)-[4-(2-methoxy-5-methylanilino)-4-oxobutan-2-ylidene]amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 17386398 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N-[(E)-[4-(2-methoxy-5-methylanilino)-4-oxobutan-2-ylidene]amino]pyrazine-2-carboxamide |
| SMILES | COc1ccc(C)cc1NC(=O)C/C(C)=N/NC(=O)c1cnccn1 |
| InChI | InChI=1S/C17H19N5O3/c1-11-4-5-15(25-3)13(8-11)20-16(23)9-12(2)21-22-17(24)14-10-18-6-7-19-14/h4-8,10H,9H2,1-3H3,(H,20,23)(H,22,24)/b21-12+ |
| InChIKey | ORCSFHXYCNBVGP-CIAFOILYSA-N |
| XLogP | 1.93 |
| TPSA | 105.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|