C30H40N2O9 — CID 17387395
(E)-but-2-enedioic acid;1-[(3,4-dimethoxyphenyl)methyl]-N-[4-methoxy-3-(2-methylpropoxy)phenyl]piperidine-3-carboxamide (PubChem CID 17387395) has the molecular formula C30H40N2O9 and a molecular weight of 572.66 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-[(3,4-dimethoxyphenyl)methyl]-N-[4-methoxy-3-(2-methylpropoxy)phenyl]piperidine-3-carboxamide.
| Compound Name | (E)-but-2-enedioic acid;1-[(3,4-dimethoxyphenyl)methyl]-N-[4-methoxy-3-(2-methylpropoxy)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 17387395 |
| Molecular Formula | C30H40N2O9 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | (E)-but-2-enedioic acid;1-[(3,4-dimethoxyphenyl)methyl]-N-[4-methoxy-3-(2-methylpropoxy)phenyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(CN2CCCC(C(=O)Nc3ccc(OC)c(OCC(C)C)c3)C2)cc1OC.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C26H36N2O5.C4H4O4/c1-18(2)17-33-25-14-21(9-11-23(25)31-4)27-26(29)20-7-6-12-28(16-20)15-19-8-10-22(30-3)24(13-19)32-5;5-3(6)1-2-4(7)8/h8-11,13-14,18,20H,6-7,12,15-17H2,1-5H3,(H,27,29);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | XVTWDQYHZFPZCT-WLHGVMLRSA-N |
| XLogP | 4.31 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|