About 3-phenylpiperidine;hydrochloride
3-phenylpiperidine;hydrochloride (PubChem CID 17390008) has the molecular formula C11H16ClN
and a molecular weight of 197.71 g/mol. Its IUPAC name is 3-phenylpiperidine;hydrochloride.
Molecular Properties
| Compound Name | 3-phenylpiperidine;hydrochloride |
| PubChem CID | 17390008 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 3-phenylpiperidine;hydrochloride |
| SMILES | Cl.c1ccc(C2CCCNC2)cc1 |
| InChI | InChI=1S/C11H15N.ClH/c1-2-5-10(6-3-1)11-7-4-8-12-9-11;/h1-3,5-6,11-12H,4,7-9H2;1H |
| InChIKey | OKVMJYYCFLIGFJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-phenylpiperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpiperidine;hydrochloride?
The IUPAC name of 3-phenylpiperidine;hydrochloride (CID 17390008) is 3-phenylpiperidine;hydrochloride.
What is the SMILES notation for 3-phenylpiperidine;hydrochloride?
The canonical SMILES for 3-phenylpiperidine;hydrochloride is Cl.c1ccc(C2CCCNC2)cc1.
What is the InChIKey of 3-phenylpiperidine;hydrochloride?
The InChIKey is OKVMJYYCFLIGFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.ClH/c1-2-5-10(6-3-1)11-7-4-8-12-9-11;/h1-3,5-6,11-12H,4,7-9H2;1H.
What are the key properties of 3-phenylpiperidine;hydrochloride?
3-phenylpiperidine;hydrochloride has a molecular weight of 197.71 g/mol, XLogP of 2.58, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpiperidine;hydrochloride is sourced from PubChem (CID 17390008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).