C12H12F6N4 — CID 17390129
N,N,9-trimethyl-2,2-bis(trifluoromethyl)pyrido[1,2-a][1,3,5]triazin-4-amine (PubChem CID 17390129) has the molecular formula C12H12F6N4 and a molecular weight of 326.24 g/mol. Its IUPAC name is N,N,9-trimethyl-2,2-bis(trifluoromethyl)pyrido[1,2-a][1,3,5]triazin-4-amine.
| Compound Name | N,N,9-trimethyl-2,2-bis(trifluoromethyl)pyrido[1,2-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 17390129 |
| Molecular Formula | C12H12F6N4 |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N,N,9-trimethyl-2,2-bis(trifluoromethyl)pyrido[1,2-a][1,3,5]triazin-4-amine |
| SMILES | CC1=CC=CN2C1=NC(C(F)(F)F)(C(F)(F)F)N=C2N(C)C |
| InChI | InChI=1S/C12H12F6N4/c1-7-5-4-6-22-8(7)19-10(11(13,14)15,12(16,17)18)20-9(22)21(2)3/h4-6H,1-3H3 |
| InChIKey | UGYDTNVAKBJCMW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |