C12H7Cl2FN2O2 — CID 17394617
2,4-dichloro-5-fluoro-N-(3-hydroxy-2-pyridinyl)benzamide (PubChem CID 17394617) has the molecular formula C12H7Cl2FN2O2 and a molecular weight of 301.10 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-(3-hydroxy-2-pyridinyl)benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-(3-hydroxy-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 17394617 |
| Molecular Formula | C12H7Cl2FN2O2 |
| Molecular Weight | 301.10 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-(3-hydroxy-2-pyridinyl)benzamide |
| SMILES | O=C(Nc1ncccc1O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H7Cl2FN2O2/c13-7-5-8(14)9(15)4-6(7)12(19)17-11-10(18)2-1-3-16-11/h1-5,18H,(H,16,17,19) |
| InChIKey | DVHBGQLWRDVUHC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.10 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|