C13H7Cl2FN2O3 — CID 63653408
2-[(2,4-dichloro-5-fluorobenzoyl)amino]pyridine-3-carboxylic acid (PubChem CID 63653408) has the molecular formula C13H7Cl2FN2O3 and a molecular weight of 329.11 g/mol. Its IUPAC name is 2-[(2,4-dichloro-5-fluorobenzoyl)amino]pyridine-3-carboxylic acid.
| Compound Name | 2-[(2,4-dichloro-5-fluorobenzoyl)amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63653408 |
| Molecular Formula | C13H7Cl2FN2O3 |
| Molecular Weight | 329.11 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 2-[(2,4-dichloro-5-fluorobenzoyl)amino]pyridine-3-carboxylic acid |
| SMILES | O=C(Nc1ncccc1C(=O)O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H7Cl2FN2O3/c14-8-5-9(15)10(16)4-7(8)12(19)18-11-6(13(20)21)2-1-3-17-11/h1-5H,(H,20,21)(H,17,18,19) |
| InChIKey | OTGNRZXHKNKUQY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.11 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|