C17H15Cl2FN2O3S — CID 17398186
N-(4-chloro-2-fluorophenyl)-2-[(4-chlorophenyl)sulfonyl-prop-2-enylamino]acetamide (PubChem CID 17398186) has the molecular formula C17H15Cl2FN2O3S and a molecular weight of 417.29 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-[(4-chlorophenyl)sulfonyl-prop-2-enylamino]acetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-[(4-chlorophenyl)sulfonyl-prop-2-enylamino]acetamide |
|---|---|
| PubChem CID | 17398186 |
| Molecular Formula | C17H15Cl2FN2O3S |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-[(4-chlorophenyl)sulfonyl-prop-2-enylamino]acetamide |
| SMILES | C=CCN(CC(=O)Nc1ccc(Cl)cc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15Cl2FN2O3S/c1-2-9-22(26(24,25)14-6-3-12(18)4-7-14)11-17(23)21-16-8-5-13(19)10-15(16)20/h2-8,10H,1,9,11H2,(H,21,23) |
| InChIKey | KTZRTLYAPUABJA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|