C19H18ClFN2O4S — CID 2476440
2-[(4-acetylphenyl)sulfonyl-prop-2-enylamino]-N-(4-chloro-2-fluorophenyl)acetamide (PubChem CID 2476440) has the molecular formula C19H18ClFN2O4S and a molecular weight of 424.88 g/mol. Its IUPAC name is 2-[(4-acetylphenyl)sulfonyl-prop-2-enylamino]-N-(4-chloro-2-fluorophenyl)acetamide.
| Compound Name | 2-[(4-acetylphenyl)sulfonyl-prop-2-enylamino]-N-(4-chloro-2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 2476440 |
| Molecular Formula | C19H18ClFN2O4S |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 2-[(4-acetylphenyl)sulfonyl-prop-2-enylamino]-N-(4-chloro-2-fluorophenyl)acetamide |
| SMILES | C=CCN(CC(=O)Nc1ccc(Cl)cc1F)S(=O)(=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C19H18ClFN2O4S/c1-3-10-23(12-19(25)22-18-9-6-15(20)11-17(18)21)28(26,27)16-7-4-14(5-8-16)13(2)24/h3-9,11H,1,10,12H2,2H3,(H,22,25) |
| InChIKey | SSRAELXRCQXFQT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|