C15H21N3S — CID 17399137
3-(5-ethyl-4-methylthiophen-2-yl)-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine (PubChem CID 17399137) has the molecular formula C15H21N3S and a molecular weight of 275.42 g/mol. Its IUPAC name is 3-(5-ethyl-4-methylthiophen-2-yl)-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine.
| Compound Name | 3-(5-ethyl-4-methylthiophen-2-yl)-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine |
|---|---|
| PubChem CID | 17399137 |
| Molecular Formula | C15H21N3S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 3-(5-ethyl-4-methylthiophen-2-yl)-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine |
| SMILES | CCc1sc(-c2nnc3n2CCCCCC3)cc1C |
| InChI | InChI=1S/C15H21N3S/c1-3-12-11(2)10-13(19-12)15-17-16-14-8-6-4-5-7-9-18(14)15/h10H,3-9H2,1-2H3 |
| InChIKey | MZGCKRNKKQOXPJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |