C13H18N2O6 — CID 17400075
[1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 5-(hydroxymethyl)-2-methylfuran-3-carboxylate (PubChem CID 17400075) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 5-(hydroxymethyl)-2-methylfuran-3-carboxylate.
| Compound Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 5-(hydroxymethyl)-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 17400075 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 5-(hydroxymethyl)-2-methylfuran-3-carboxylate |
| SMILES | CCNC(=O)NC(=O)C(C)OC(=O)c1cc(CO)oc1C |
| InChI | InChI=1S/C13H18N2O6/c1-4-14-13(19)15-11(17)8(3)21-12(18)10-5-9(6-16)20-7(10)2/h5,8,16H,4,6H2,1-3H3,(H2,14,15,17,19) |
| InChIKey | MFGOVWBWELBVLD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |