C16H18ClN5O2S — CID 174000989
1-amino-N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]-3-methyliminoprop-1-ene-2-sulfonamide (PubChem CID 174000989) has the molecular formula C16H18ClN5O2S and a molecular weight of 379.87 g/mol. Its IUPAC name is 1-amino-N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]-3-methyliminoprop-1-ene-2-sulfonamide.
| Compound Name | 1-amino-N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]-3-methyliminoprop-1-ene-2-sulfonamide |
|---|---|
| PubChem CID | 174000989 |
| Molecular Formula | C16H18ClN5O2S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 1-amino-N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]-3-methyliminoprop-1-ene-2-sulfonamide |
| SMILES | C/N=C/C(=CN)S(=O)(=O)Nc1nc(Cl)cc(-c2c(C)cccc2C)n1 |
| InChI | InChI=1S/C16H18ClN5O2S/c1-10-5-4-6-11(2)15(10)13-7-14(17)21-16(20-13)22-25(23,24)12(8-18)9-19-3/h4-9H,18H2,1-3H3,(H,20,21,22)/b12-8?,19-9+ |
| InChIKey | MXQYSTFLHSWTEA-AKMIETQNSA-N |
| XLogP | 2.66 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|