C22H43N — CID 174001741
(4R)-4,6-dimethyl-2,7-di(propan-2-yl)tetradecanenitrile (PubChem CID 174001741) has the molecular formula C22H43N and a molecular weight of 321.59 g/mol. Its IUPAC name is (4R)-4,6-dimethyl-2,7-di(propan-2-yl)tetradecanenitrile.
| Compound Name | (4R)-4,6-dimethyl-2,7-di(propan-2-yl)tetradecanenitrile |
|---|---|
| PubChem CID | 174001741 |
| Molecular Formula | C22H43N |
| Molecular Weight | 321.59 g/mol |
| Exact Mass | 321.34 |
| IUPAC Name | (4R)-4,6-dimethyl-2,7-di(propan-2-yl)tetradecanenitrile |
| SMILES | CCCCCCCC(C(C)C)C(C)C[C@@H](C)CC(C#N)C(C)C |
| InChI | InChI=1S/C22H43N/c1-8-9-10-11-12-13-22(18(4)5)20(7)14-19(6)15-21(16-23)17(2)3/h17-22H,8-15H2,1-7H3/t19-,20?,21?,22?/m1/s1 |
| InChIKey | UARIESQEPRSSNI-AOFALMCMSA-N |
| XLogP | 7.47 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.59 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|