C9H19NO4 — CID 174002662
N-[(2R)-2-hydroxy-2-(4-hydroxypentan-2-yloxy)ethyl]acetamide (PubChem CID 174002662) has the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-2-(4-hydroxypentan-2-yloxy)ethyl]acetamide.
| Compound Name | N-[(2R)-2-hydroxy-2-(4-hydroxypentan-2-yloxy)ethyl]acetamide |
|---|---|
| PubChem CID | 174002662 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N-[(2R)-2-hydroxy-2-(4-hydroxypentan-2-yloxy)ethyl]acetamide |
| SMILES | CC(=O)NC[C@H](O)OC(C)CC(C)O |
| InChI | InChI=1S/C9H19NO4/c1-6(11)4-7(2)14-9(13)5-10-8(3)12/h6-7,9,11,13H,4-5H2,1-3H3,(H,10,12)/t6?,7?,9-/m1/s1 |
| InChIKey | JVWSESUEHFNQHA-QXUHLLMWSA-N |
| XLogP | -0.38 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|