C30H42N2O3 — CID 174005100
[(6S)-6-[[(2R)-butan-2-yl]-propylamino]-5,6,7,8-tetrahydronaphthalen-1-yl] 4-(3-phenylpropanoylamino)butanoate (PubChem CID 174005100) has the molecular formula C30H42N2O3 and a molecular weight of 478.68 g/mol. Its IUPAC name is [(6S)-6-[[(2R)-butan-2-yl]-propylamino]-5,6,7,8-tetrahydronaphthalen-1-yl] 4-(3-phenylpropanoylamino)butanoate.
| Compound Name | [(6S)-6-[[(2R)-butan-2-yl]-propylamino]-5,6,7,8-tetrahydronaphthalen-1-yl] 4-(3-phenylpropanoylamino)butanoate |
|---|---|
| PubChem CID | 174005100 |
| Molecular Formula | C30H42N2O3 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.32 |
| IUPAC Name | [(6S)-6-[[(2R)-butan-2-yl]-propylamino]-5,6,7,8-tetrahydronaphthalen-1-yl] 4-(3-phenylpropanoylamino)butanoate |
| SMILES | CCCN([C@H]1CCc2c(cccc2OC(=O)CCCNC(=O)CCc2ccccc2)C1)[C@H](C)CC |
| InChI | InChI=1S/C30H42N2O3/c1-4-21-32(23(3)5-2)26-17-18-27-25(22-26)13-9-14-28(27)35-30(34)15-10-20-31-29(33)19-16-24-11-7-6-8-12-24/h6-9,11-14,23,26H,4-5,10,15-22H2,1-3H3,(H,31,33)/t23-,26+/m1/s1 |
| InChIKey | GPNXOHFXSHTTEU-BVAGGSTKSA-N |
| XLogP | 5.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|