C23H30N4O3 — CID 174005942
3-[6-[(5S)-6-ethyl-8-methyl-6,8-diazabicyclo[3.2.2]nonan-3-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 174005942) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-[6-[(5S)-6-ethyl-8-methyl-6,8-diazabicyclo[3.2.2]nonan-3-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(5S)-6-ethyl-8-methyl-6,8-diazabicyclo[3.2.2]nonan-3-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 174005942 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 3-[6-[(5S)-6-ethyl-8-methyl-6,8-diazabicyclo[3.2.2]nonan-3-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCN1CC2CC(c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)C[C@H]1CN2C |
| InChI | InChI=1S/C23H30N4O3/c1-3-26-13-17-9-15(10-18(26)12-25(17)2)14-4-5-19-16(8-14)11-27(23(19)30)20-6-7-21(28)24-22(20)29/h4-5,8,15,17-18,20H,3,6-7,9-13H2,1-2H3,(H,24,28,29)/t15?,17?,18-,20?/m0/s1 |
| InChIKey | LQAUCSDWDVDDGN-NZXVLACBSA-N |
| XLogP | 1.33 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|