C11H18N2 — CID 174007836
(4Z)-2,5,8-trimethyl-1,2,3,10-tetrahydro-1,6-diazecine (PubChem CID 174007836) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (4Z)-2,5,8-trimethyl-1,2,3,10-tetrahydro-1,6-diazecine.
| Compound Name | (4Z)-2,5,8-trimethyl-1,2,3,10-tetrahydro-1,6-diazecine |
|---|---|
| PubChem CID | 174007836 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (4Z)-2,5,8-trimethyl-1,2,3,10-tetrahydro-1,6-diazecine |
| SMILES | CC1=CCNC(C)C/C=C(C)\N=C\1 |
| InChI | InChI=1S/C11H18N2/c1-9-6-7-12-10(2)4-5-11(3)13-8-9/h5-6,8,10,12H,4,7H2,1-3H3/b9-6?,11-5-,13-8+ |
| InChIKey | ZLUBFNUFLUBPNB-MAJQTHRCSA-N |
| XLogP | 2.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |