C18H32O3 — CID 174008699
(3aR,4S,5R,7S)-7-ethyl-4,5-dimethyl-2,3,5,6,6a,8,9,10,10a,10b-decahydro-1H-benzo[h]azulene-3a,4,7-triol (PubChem CID 174008699) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is (3aR,4S,5R,7S)-7-ethyl-4,5-dimethyl-2,3,5,6,6a,8,9,10,10a,10b-decahydro-1H-benzo[h]azulene-3a,4,7-triol.
| Compound Name | (3aR,4S,5R,7S)-7-ethyl-4,5-dimethyl-2,3,5,6,6a,8,9,10,10a,10b-decahydro-1H-benzo[h]azulene-3a,4,7-triol |
|---|---|
| PubChem CID | 174008699 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | (3aR,4S,5R,7S)-7-ethyl-4,5-dimethyl-2,3,5,6,6a,8,9,10,10a,10b-decahydro-1H-benzo[h]azulene-3a,4,7-triol |
| SMILES | CC[C@]1(O)CCCC2C1C[C@@H](C)[C@](C)(O)[C@@]1(O)CCCC21 |
| InChI | InChI=1S/C18H32O3/c1-4-17(20)9-5-7-13-14-8-6-10-18(14,21)16(3,19)12(2)11-15(13)17/h12-15,19-21H,4-11H2,1-3H3/t12-,13?,14?,15?,16+,17+,18-/m1/s1 |
| InChIKey | JWYWNLRSPWJMTJ-VUWCOSMMSA-N |
| XLogP | 2.87 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |