C16H14F4N2O — CID 174010715
N-[[(3Z)-2-fluoro-7-[6-(trifluoromethyl)-3-pyridinyl]cycloocta-1,3,7-trien-1-yl]methyl]formamide (PubChem CID 174010715) has the molecular formula C16H14F4N2O and a molecular weight of 326.29 g/mol. Its IUPAC name is N-[[(3Z)-2-fluoro-7-[6-(trifluoromethyl)-3-pyridinyl]cycloocta-1,3,7-trien-1-yl]methyl]formamide.
| Compound Name | N-[[(3Z)-2-fluoro-7-[6-(trifluoromethyl)-3-pyridinyl]cycloocta-1,3,7-trien-1-yl]methyl]formamide |
|---|---|
| PubChem CID | 174010715 |
| Molecular Formula | C16H14F4N2O |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-[[(3Z)-2-fluoro-7-[6-(trifluoromethyl)-3-pyridinyl]cycloocta-1,3,7-trien-1-yl]methyl]formamide |
| SMILES | O=CNCC1=C(F)/C=C\CCC(c2ccc(C(F)(F)F)nc2)=C1 |
| InChI | InChI=1S/C16H14F4N2O/c17-14-4-2-1-3-11(7-13(14)8-21-10-23)12-5-6-15(22-9-12)16(18,19)20/h2,4-7,9-10H,1,3,8H2,(H,21,23)/b4-2-,11-7?,14-13? |
| InChIKey | ZJGHLUIQNDDYFM-KYTWMIPTSA-N |
| XLogP | 3.80 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|