C11H10F4N2O — CID 122490223
N-[[2-cyclopropyl-3-fluoro-6-(trifluoromethyl)-4-pyridinyl]methyl]formamide (PubChem CID 122490223) has the molecular formula C11H10F4N2O and a molecular weight of 262.21 g/mol. Its IUPAC name is N-[[2-cyclopropyl-3-fluoro-6-(trifluoromethyl)-4-pyridinyl]methyl]formamide.
| Compound Name | N-[[2-cyclopropyl-3-fluoro-6-(trifluoromethyl)-4-pyridinyl]methyl]formamide |
|---|---|
| PubChem CID | 122490223 |
| Molecular Formula | C11H10F4N2O |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | N-[[2-cyclopropyl-3-fluoro-6-(trifluoromethyl)-4-pyridinyl]methyl]formamide |
| SMILES | O=CNCc1cc(C(F)(F)F)nc(C2CC2)c1F |
| InChI | InChI=1S/C11H10F4N2O/c12-9-7(4-16-5-18)3-8(11(13,14)15)17-10(9)6-1-2-6/h3,5-6H,1-2,4H2,(H,16,18) |
| InChIKey | MNTVYYHLDFWNNX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|