C10H11F3N2 — CID 139563775
2-cyclopropyl-4-methyl-6-(trifluoromethyl)pyridin-3-amine (PubChem CID 139563775) has the molecular formula C10H11F3N2 and a molecular weight of 216.21 g/mol. Its IUPAC name is 2-cyclopropyl-4-methyl-6-(trifluoromethyl)pyridin-3-amine.
| Compound Name | 2-cyclopropyl-4-methyl-6-(trifluoromethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 139563775 |
| Molecular Formula | C10H11F3N2 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-cyclopropyl-4-methyl-6-(trifluoromethyl)pyridin-3-amine |
| SMILES | Cc1cc(C(F)(F)F)nc(C2CC2)c1N |
| InChI | InChI=1S/C10H11F3N2/c1-5-4-7(10(11,12)13)15-9(8(5)14)6-2-3-6/h4,6H,2-3,14H2,1H3 |
| InChIKey | GUMPUGYCSYYXAZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |