C21H14F3N5O3 — CID 176830833
5-[6-[[2-cyclopropyl-4-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]-5-nitro-2-pyridinyl]pyridine-3-carbonitrile (PubChem CID 176830833) has the molecular formula C21H14F3N5O3 and a molecular weight of 441.37 g/mol. Its IUPAC name is 5-[6-[[2-cyclopropyl-4-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]-5-nitro-2-pyridinyl]pyridine-3-carbonitrile.
| Compound Name | 5-[6-[[2-cyclopropyl-4-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]-5-nitro-2-pyridinyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 176830833 |
| Molecular Formula | C21H14F3N5O3 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 5-[6-[[2-cyclopropyl-4-methyl-6-(trifluoromethyl)-3-pyridinyl]oxy]-5-nitro-2-pyridinyl]pyridine-3-carbonitrile |
| SMILES | Cc1cc(C(F)(F)F)nc(C2CC2)c1Oc1nc(-c2cncc(C#N)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H14F3N5O3/c1-11-6-17(21(22,23)24)28-18(13-2-3-13)19(11)32-20-16(29(30)31)5-4-15(27-20)14-7-12(8-25)9-26-10-14/h4-7,9-10,13H,2-3H2,1H3 |
| InChIKey | FOFNUWCLJSNSAG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 114.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|