C19H15N5O4 — CID 176830626
5-[6-[(6-methoxy-2,4-dimethyl-3-pyridinyl)oxy]-5-nitro-2-pyridinyl]pyridine-3-carbonitrile (PubChem CID 176830626) has the molecular formula C19H15N5O4 and a molecular weight of 377.36 g/mol. Its IUPAC name is 5-[6-[(6-methoxy-2,4-dimethyl-3-pyridinyl)oxy]-5-nitro-2-pyridinyl]pyridine-3-carbonitrile.
| Compound Name | 5-[6-[(6-methoxy-2,4-dimethyl-3-pyridinyl)oxy]-5-nitro-2-pyridinyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 176830626 |
| Molecular Formula | C19H15N5O4 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 5-[6-[(6-methoxy-2,4-dimethyl-3-pyridinyl)oxy]-5-nitro-2-pyridinyl]pyridine-3-carbonitrile |
| SMILES | COc1cc(C)c(Oc2nc(-c3cncc(C#N)c3)ccc2[N+](=O)[O-])c(C)n1 |
| InChI | InChI=1S/C19H15N5O4/c1-11-6-17(27-3)22-12(2)18(11)28-19-16(24(25)26)5-4-15(23-19)14-7-13(8-20)9-21-10-14/h4-7,9-10H,1-3H3 |
| InChIKey | XECZUACBGPJAHF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 124.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|