C17H11N5O3 — CID 143991068
5-[6-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]-5-methoxy-2-pyridinyl]pyridine-3-carbonitrile (PubChem CID 143991068) has the molecular formula C17H11N5O3 and a molecular weight of 333.31 g/mol. Its IUPAC name is 5-[6-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]-5-methoxy-2-pyridinyl]pyridine-3-carbonitrile.
| Compound Name | 5-[6-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]-5-methoxy-2-pyridinyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 143991068 |
| Molecular Formula | C17H11N5O3 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 5-[6-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]-5-methoxy-2-pyridinyl]pyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2cncc(C#N)c2)nc1C#CC1NC(=O)NC1=O |
| InChI | InChI=1S/C17H11N5O3/c1-25-15-5-4-12(11-6-10(7-18)8-19-9-11)20-13(15)2-3-14-16(23)22-17(24)21-14/h4-6,8-9,14H,1H3,(H2,21,22,23,24) |
| InChIKey | JDUJQSDXTWKEPH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|