C29H24N6O6 — CID 176564964
1-[1-[4-(5-cyano-3-pyridinyl)-2-methoxyphenyl]ethyl]-3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]urea (PubChem CID 176564964) has the molecular formula C29H24N6O6 and a molecular weight of 552.55 g/mol. Its IUPAC name is 1-[1-[4-(5-cyano-3-pyridinyl)-2-methoxyphenyl]ethyl]-3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]urea.
| Compound Name | 1-[1-[4-(5-cyano-3-pyridinyl)-2-methoxyphenyl]ethyl]-3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]urea |
|---|---|
| PubChem CID | 176564964 |
| Molecular Formula | C29H24N6O6 |
| Molecular Weight | 552.55 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 1-[1-[4-(5-cyano-3-pyridinyl)-2-methoxyphenyl]ethyl]-3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]urea |
| SMILES | COc1cc(-c2cncc(C#N)c2)ccc1C(C)NC(=O)Nc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C29H24N6O6/c1-15(20-5-3-17(10-24(20)41-2)18-9-16(12-30)13-31-14-18)32-29(40)33-19-4-6-21-22(11-19)28(39)35(27(21)38)23-7-8-25(36)34-26(23)37/h3-6,9-11,13-15,23H,7-8H2,1-2H3,(H2,32,33,40)(H,34,36,37) |
| InChIKey | WHIHQSSSFULXJA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 170.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|