C23H30N9O11P — CID 174011270
[(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2-[(2R,3S,4R,5R)-5-(6-ethylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethyl hydrogen phosphate (PubChem CID 174011270) has the molecular formula C23H30N9O11P and a molecular weight of 639.52 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2-[(2R,3S,4R,5R)-5-(6-ethylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethyl hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2-[(2R,3S,4R,5R)-5-(6-ethylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 174011270 |
| Molecular Formula | C23H30N9O11P |
| Molecular Weight | 639.52 g/mol |
| Exact Mass | 639.18 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2-[(2R,3S,4R,5R)-5-(6-ethylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethyl hydrogen phosphate |
| SMILES | CCc1ncnc2c1ncn2[C@@H]1O[C@H](CCOP(=O)(O)O[C@@H]2[C@H](O)[C@@H](CO)O[C@H]2n2cnc3c(=O)[nH]c(N)nc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C23H30N9O11P/c1-2-9-12-18(26-6-25-9)31(7-27-12)21-16(36)14(34)10(41-21)3-4-40-44(38,39)43-17-15(35)11(5-33)42-22(17)32-8-28-13-19(32)29-23(24)30-20(13)37/h6-8,10-11,14-17,21-22,33-36H,2-5H2,1H3,(H,38,39)(H3,24,29,30,37)/t10-,11-,14-,15-,16-,17-,21-,22-/m1/s1 |
| InChIKey | BRAHGGZPAVKOKM-NRJOTZKJSA-N |
| XLogP | -2.13 |
| TPSA | 288.33 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.52 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|