C21H25N10O11P — CID 137149052
[(2R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] [(1R,3R)-3-(6-aminopurin-9-yl)-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methyl hydrogen phosphate (PubChem CID 137149052) has the molecular formula C21H25N10O11P and a molecular weight of 624.46 g/mol. Its IUPAC name is [(2R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] [(1R,3R)-3-(6-aminopurin-9-yl)-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] [(1R,3R)-3-(6-aminopurin-9-yl)-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 137149052 |
| Molecular Formula | C21H25N10O11P |
| Molecular Weight | 624.46 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | [(2R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] [(1R,3R)-3-(6-aminopurin-9-yl)-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methyl hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](CO)C(O)C2OP(=O)(O)OC[C@]23COC(C2O)[C@H](n2cnc4c(N)ncnc42)O3)c(=O)[nH]1 |
| InChI | InChI=1S/C21H25N10O11P/c22-14-8-15(25-4-24-14)30(5-26-8)19-12-13(34)21(41-19,2-38-12)3-39-43(36,37)42-11-10(33)7(1-32)40-18(11)31-6-27-9-16(31)28-20(23)29-17(9)35/h4-7,10-13,18-19,32-34H,1-3H2,(H,36,37)(H2,22,24,25)(H3,23,28,29,35)/t7-,10?,11?,12?,13?,18-,19-,21-/m1/s1 |
| InChIKey | DFMMULSPDRNXCD-VTJZGESPSA-N |
| XLogP | -3.10 |
| TPSA | 303.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.46 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|