C20H24FN11O10P2S2 — CID 161359522
CID 161359522 (PubChem CID 161359522) has the molecular formula C20H24FN11O10P2S2 and a molecular weight of 723.56 g/mol.
| Compound Name | CID 161359522 |
|---|---|
| PubChem CID | 161359522 |
| Molecular Formula | C20H24FN11O10P2S2 |
| Molecular Weight | 723.56 g/mol |
| Exact Mass | 723.06 |
| IUPAC Name | — |
| SMILES | Nc1nc2c(nnn2[C@@H]2O[C@H](CO)[C@H](F)[C@H]2OP(O)(=S)OC[C@@]23CO[C@@H]([C@H](n4cnc5c(N)ncnc54)O2)[C@@H]3O)c(=O)[nH]1.O=PS |
| InChI | InChI=1S/C20H23FN11O9PS.HOPS/c21-7-6(1-33)39-18(32-15-9(29-30-32)16(35)28-19(23)27-15)10(7)41-42(36,43)38-3-20-2-37-11(12(20)34)17(40-20)31-5-26-8-13(22)24-4-25-14(8)31;1-2-3/h4-7,10-12,17-18,33-34H,1-3H2,(H,36,43)(H2,22,24,25)(H3,23,27,28,35);(H,1,3)/t6-,7+,10-,11-,12+,17-,18-,20-,42?;/m1./s1 |
| InChIKey | VOZKXBUXPBCSCK-SGAJXUFPSA-N |
| XLogP | -1.48 |
| TPSA | 296.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.56 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|