C10H21F2NOS — CID 174013313
tert-butyl-[[(3R)-6,6-difluorohexan-3-yl]amino]-oxidosulfanium (PubChem CID 174013313) has the molecular formula C10H21F2NOS and a molecular weight of 241.35 g/mol. Its IUPAC name is tert-butyl-[[(3R)-6,6-difluorohexan-3-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(3R)-6,6-difluorohexan-3-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 174013313 |
| Molecular Formula | C10H21F2NOS |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | tert-butyl-[[(3R)-6,6-difluorohexan-3-yl]amino]-oxidosulfanium |
| SMILES | CC[C@H](CCC(F)F)N[S+]([O-])C(C)(C)C |
| InChI | InChI=1S/C10H21F2NOS/c1-5-8(6-7-9(11)12)13-15(14)10(2,3)4/h8-9,13H,5-7H2,1-4H3/t8-,15?/m1/s1 |
| InChIKey | RPVSFTNXZCFLDX-ARAKYBCZSA-N |
| XLogP | 2.86 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|