C30H31F2N7O3 — CID 174013609
2-amino-3-[1-[7-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide (PubChem CID 174013609) has the molecular formula C30H31F2N7O3 and a molecular weight of 575.62 g/mol. Its IUPAC name is 2-amino-3-[1-[7-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide.
| Compound Name | 2-amino-3-[1-[7-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 174013609 |
| Molecular Formula | C30H31F2N7O3 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | 2-amino-3-[1-[7-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide |
| SMILES | CCc1c(F)ccc2cc(O)cc(-c3ncc4c(N5CCCN=C(C=C(N)C(=O)N(C)C)C5)nc(OC)nc4c3F)c12 |
| InChI | InChI=1S/C30H31F2N7O3/c1-5-19-22(31)8-7-16-11-18(40)13-20(24(16)19)26-25(32)27-21(14-35-26)28(37-30(36-27)42-4)39-10-6-9-34-17(15-39)12-23(33)29(41)38(2)3/h7-8,11-14,40H,5-6,9-10,15,33H2,1-4H3 |
| InChIKey | IHKRXQMMCQEVRS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 130.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|