C45H46BN2 — CID 174018532
CID 174018532 (PubChem CID 174018532) has the molecular formula C45H46BN2 and a molecular weight of 625.69 g/mol.
| Compound Name | CID 174018532 |
|---|---|
| PubChem CID | 174018532 |
| Molecular Formula | C45H46BN2 |
| Molecular Weight | 625.69 g/mol |
| Exact Mass | 625.38 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc2c3c(c1)C1(C)CCCCC1(C)N3c1cc(-c3ccccc3)cc(-c3cccc4c3Nc3ccccc3C4(C)C)c1[B]2 |
| InChI | InChI=1S/C45H46BN2/c1-42(2,3)30-26-35-41-36(27-30)46-39-32(31-18-15-20-34-40(31)47-37-21-12-11-19-33(37)43(34,4)5)24-29(28-16-9-8-10-17-28)25-38(39)48(41)45(7)23-14-13-22-44(35,45)6/h8-12,15-21,24-27,47H,13-14,22-23H2,1-7H3 |
| InChIKey | OUFFABVCLWNHDW-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.69 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|