C52H62BN2 — CID 174014396
CID 174014396 (PubChem CID 174014396) has the molecular formula C52H62BN2 and a molecular weight of 725.89 g/mol.
| Compound Name | CID 174014396 |
|---|---|
| PubChem CID | 174014396 |
| Molecular Formula | C52H62BN2 |
| Molecular Weight | 725.89 g/mol |
| Exact Mass | 725.50 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1-c1cc(-c2ccc(C(C)(C)C)cc2Nc2ccc(C(C)(C)C)cc2)c2c(c1)N1c3c(cc(C(C)(C)C)cc3C3(C)CCCCC13C)[B]2 |
| InChI | InChI=1S/C52H62BN2/c1-32-17-16-18-33(2)45(32)34-27-40(39-24-21-36(49(6,7)8)31-43(39)54-38-22-19-35(20-23-38)48(3,4)5)46-44(28-34)55-47-41(51(12)25-14-15-26-52(51,55)13)29-37(50(9,10)11)30-42(47)53-46/h16-24,27-31,54H,14-15,25-26H2,1-13H3 |
| InChIKey | OVCXUYDPYCOICW-UHFFFAOYSA-N |
| XLogP | 12.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.89 |
| LogP ≤ 5 | 12.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|