C29H30Si — CID 174021636
[3-(2,2-dimethylpropyl)phenyl]-triphenylsilane (PubChem CID 174021636) has the molecular formula C29H30Si and a molecular weight of 406.65 g/mol. Its IUPAC name is [3-(2,2-dimethylpropyl)phenyl]-triphenylsilane.
| Compound Name | [3-(2,2-dimethylpropyl)phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 174021636 |
| Molecular Formula | C29H30Si |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | [3-(2,2-dimethylpropyl)phenyl]-triphenylsilane |
| SMILES | CC(C)(C)Cc1cccc([Si](c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C29H30Si/c1-29(2,3)23-24-14-13-21-28(22-24)30(25-15-7-4-8-16-25,26-17-9-5-10-18-26)27-19-11-6-12-20-27/h4-22H,23H2,1-3H3 |
| InChIKey | XEESPELBCWJTKU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|