C8H11NS — CID 174023134
(4S)-4-[(2Z)-penta-2,4-dien-2-yl]-4,5-dihydro-1,3-thiazole (PubChem CID 174023134) has the molecular formula C8H11NS and a molecular weight of 153.25 g/mol. Its IUPAC name is (4S)-4-[(2Z)-penta-2,4-dien-2-yl]-4,5-dihydro-1,3-thiazole.
| Compound Name | (4S)-4-[(2Z)-penta-2,4-dien-2-yl]-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 174023134 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | (4S)-4-[(2Z)-penta-2,4-dien-2-yl]-4,5-dihydro-1,3-thiazole |
| SMILES | C=C/C=C(/C)[C@H]1CSC=N1 |
| InChI | InChI=1S/C8H11NS/c1-3-4-7(2)8-5-10-6-9-8/h3-4,6,8H,1,5H2,2H3/b7-4-/t8-/m1/s1 |
| InChIKey | OVULLAGOFPOWIK-RBMBQVQZSA-N |
| XLogP | 2.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|