C29H29BN4O3 — CID 174023468
CID 174023468 (PubChem CID 174023468) has the molecular formula C29H29BN4O3 and a molecular weight of 492.39 g/mol.
| Compound Name | CID 174023468 |
|---|---|
| PubChem CID | 174023468 |
| Molecular Formula | C29H29BN4O3 |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | — |
| SMILES | [B][C@]1(N2C(=O)c3cccc4c(Cc5ccc(CN6CCN(C)CC6)cc5)ccc2c34)CCC(=O)NC1=O |
| InChI | InChI=1S/C29H29BN4O3/c1-32-13-15-33(16-14-32)18-20-7-5-19(6-8-20)17-21-9-10-24-26-22(21)3-2-4-23(26)27(36)34(24)29(30)12-11-25(35)31-28(29)37/h2-10H,11-18H2,1H3,(H,31,35,37)/t29-/m0/s1 |
| InChIKey | VNKYXFLNQPZHIP-LJAQVGFWSA-N |
| XLogP | 2.44 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|