C9H21NO4S — CID 174024352
(1R,5S)-4-amino-5-(2-hydroxyethoxy)-1-methoxy-1-sulfanylhexan-2-ol (PubChem CID 174024352) has the molecular formula C9H21NO4S and a molecular weight of 239.34 g/mol. Its IUPAC name is (1R,5S)-4-amino-5-(2-hydroxyethoxy)-1-methoxy-1-sulfanylhexan-2-ol.
| Compound Name | (1R,5S)-4-amino-5-(2-hydroxyethoxy)-1-methoxy-1-sulfanylhexan-2-ol |
|---|---|
| PubChem CID | 174024352 |
| Molecular Formula | C9H21NO4S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | (1R,5S)-4-amino-5-(2-hydroxyethoxy)-1-methoxy-1-sulfanylhexan-2-ol |
| SMILES | CO[C@H](S)C(O)CC(N)[C@H](C)OCCO |
| InChI | InChI=1S/C9H21NO4S/c1-6(14-4-3-11)7(10)5-8(12)9(15)13-2/h6-9,11-12,15H,3-5,10H2,1-2H3/t6-,7?,8?,9+/m0/s1 |
| InChIKey | OMOIJPYSLGUULH-DFAZKQQPSA-N |
| XLogP | -0.64 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|