About CID 174026996
CID 174026996 (PubChem CID 174026996) has the molecular formula C5H9BS
and a molecular weight of 112.01 g/mol.
Molecular Properties
| Compound Name | CID 174026996 |
| PubChem CID | 174026996 |
| Molecular Formula | C5H9BS |
| Molecular Weight | 112.01 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | — |
| SMILES | [B]SC(=C)C(C)C |
| InChI | InChI=1S/C5H9BS/c1-4(2)5(3)7-6/h4H,3H2,1-2H3 |
| InChIKey | NRFLCQYMQJZRLQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.01 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174026996 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174026996?
The IUPAC name of CID 174026996 (CID 174026996) is not available.
What is the SMILES notation for CID 174026996?
The canonical SMILES for CID 174026996 is [B]SC(=C)C(C)C.
What is the InChIKey of CID 174026996?
The InChIKey is NRFLCQYMQJZRLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9BS/c1-4(2)5(3)7-6/h4H,3H2,1-2H3.
What are the key properties of CID 174026996?
CID 174026996 has a molecular weight of 112.01 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174026996 is sourced from PubChem (CID 174026996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).