C9H17N3 — CID 174028770
N-[1-[[(Z)-but-2-enylidene]amino]ethenyl]-N',N'-dimethylmethanediamine (PubChem CID 174028770) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is N-[1-[[(Z)-but-2-enylidene]amino]ethenyl]-N',N'-dimethylmethanediamine.
| Compound Name | N-[1-[[(Z)-but-2-enylidene]amino]ethenyl]-N',N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 174028770 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | N-[1-[[(Z)-but-2-enylidene]amino]ethenyl]-N',N'-dimethylmethanediamine |
| SMILES | C=C(N=C/C=C\C)NCN(C)C |
| InChI | InChI=1S/C9H17N3/c1-5-6-7-10-9(2)11-8-12(3)4/h5-7,11H,2,8H2,1,3-4H3/b6-5-,10-7? |
| InChIKey | LOUAUOUUHQHASM-WONFBAJKSA-N |
| XLogP | 1.21 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|