C7H14N4 — CID 174090838
(Z)-3-[1-(2,2-dimethylhydrazinyl)ethenylimino]prop-1-en-1-amine (PubChem CID 174090838) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is (Z)-3-[1-(2,2-dimethylhydrazinyl)ethenylimino]prop-1-en-1-amine.
| Compound Name | (Z)-3-[1-(2,2-dimethylhydrazinyl)ethenylimino]prop-1-en-1-amine |
|---|---|
| PubChem CID | 174090838 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | (Z)-3-[1-(2,2-dimethylhydrazinyl)ethenylimino]prop-1-en-1-amine |
| SMILES | C=C(N=C/C=C\N)NN(C)C |
| InChI | InChI=1S/C7H14N4/c1-7(10-11(2)3)9-6-4-5-8/h4-6,10H,1,8H2,2-3H3/b5-4-,9-6? |
| InChIKey | XHQRWMSPTOIJAQ-QRSARNIISA-N |
| XLogP | 0.07 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|