C3H10N4 — CID 152801962
N'-(2,2-dimethylhydrazinyl)methanimidamide (PubChem CID 152801962) has the molecular formula C3H10N4 and a molecular weight of 102.14 g/mol. Its IUPAC name is N'-(2,2-dimethylhydrazinyl)methanimidamide.
| Compound Name | N'-(2,2-dimethylhydrazinyl)methanimidamide |
|---|---|
| PubChem CID | 152801962 |
| Molecular Formula | C3H10N4 |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.09 |
| IUPAC Name | N'-(2,2-dimethylhydrazinyl)methanimidamide |
| SMILES | CN(C)N/N=C/N |
| InChI | InChI=1S/C3H10N4/c1-7(2)6-5-3-4/h3,6H,1-2H3,(H2,4,5) |
| InChIKey | SNVBAXLZYPBKJH-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|