C4H9N3 — CID 154475893
(Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine (PubChem CID 154475893) has the molecular formula C4H9N3 and a molecular weight of 99.14 g/mol. Its IUPAC name is (Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine.
| Compound Name | (Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine |
|---|---|
| PubChem CID | 154475893 |
| Molecular Formula | C4H9N3 |
| Molecular Weight | 99.14 g/mol |
| Exact Mass | 99.08 |
| IUPAC Name | (Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine |
| SMILES | C=NN(C)/C=C\N |
| InChI | InChI=1S/C4H9N3/c1-6-7(2)4-3-5/h3-4H,1,5H2,2H3/b4-3- |
| InChIKey | SGVDLIAXLDNPKS-ARJAWSKDSA-N |
| XLogP | -0.04 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.14 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|