About (Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine
(Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine (PubChem CID 154475893) has the molecular formula C4H9N3
and a molecular weight of 99.14 g/mol. Its IUPAC name is (Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine |
| PubChem CID | 154475893 |
| Molecular Formula | C4H9N3 |
| Molecular Weight | 99.14 g/mol |
| Exact Mass | 99.08 |
| IUPAC Name | (Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine |
| SMILES | C=NN(C)/C=C\N |
| InChI | InChI=1S/C4H9N3/c1-6-7(2)4-3-5/h3-4H,1,5H2,2H3/b4-3- |
| InChIKey | SGVDLIAXLDNPKS-ARJAWSKDSA-N |
| XLogP | -0.04 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.14 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine?
The IUPAC name of (Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine (CID 154475893) is (Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine.
What is the SMILES notation for (Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine?
The canonical SMILES for (Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine is C=NN(C)/C=C\N.
What is the InChIKey of (Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine?
The InChIKey is SGVDLIAXLDNPKS-ARJAWSKDSA-N. The full InChI is InChI=1S/C4H9N3/c1-6-7(2)4-3-5/h3-4H,1,5H2,2H3/b4-3-.
What are the key properties of (Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine?
(Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine has a molecular weight of 99.14 g/mol, XLogP of -0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N'-methyl-N'-(methylideneamino)ethene-1,2-diamine is sourced from PubChem (CID 154475893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).