C27H31N3O5Si — CID 174029612
CID 174029612 (PubChem CID 174029612) has the molecular formula C27H31N3O5Si and a molecular weight of 505.65 g/mol.
| Compound Name | CID 174029612 |
|---|---|
| PubChem CID | 174029612 |
| Molecular Formula | C27H31N3O5Si |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | — |
| SMILES | CCC[C@H]([Si]NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
| InChI | InChI=1S/C27H31N3O5Si/c1-2-7-24(26(33)29-18(15-31)14-17-12-13-28-25(17)32)36-30-27(34)35-16-23-21-10-5-3-8-19(21)20-9-4-6-11-22(20)23/h3-6,8-11,15,17-18,23-24H,2,7,12-14,16H2,1H3,(H,28,32)(H,29,33)(H,30,34)/t17-,18-,24-/m0/s1 |
| InChIKey | NPPGEYFZPQMZPZ-XFAGBWLFSA-N |
| XLogP | 2.94 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|