C24H46O6Si — CID 174031467
tert-butyl (E)-6-[(2S,3R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-6-methyloxan-2-yl]oxy-6-methylhept-2-enoate (PubChem CID 174031467) has the molecular formula C24H46O6Si and a molecular weight of 458.71 g/mol. Its IUPAC name is tert-butyl (E)-6-[(2S,3R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-6-methyloxan-2-yl]oxy-6-methylhept-2-enoate.
| Compound Name | tert-butyl (E)-6-[(2S,3R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-6-methyloxan-2-yl]oxy-6-methylhept-2-enoate |
|---|---|
| PubChem CID | 174031467 |
| Molecular Formula | C24H46O6Si |
| Molecular Weight | 458.71 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | tert-butyl (E)-6-[(2S,3R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-6-methyloxan-2-yl]oxy-6-methylhept-2-enoate |
| SMILES | C[C@@H]1O[C@@H](OC(C)(C)CC/C=C/C(=O)OC(C)(C)C)[C@H](O)CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O6Si/c1-17-19(30-31(10,11)23(5,6)7)16-18(25)21(27-17)29-24(8,9)15-13-12-14-20(26)28-22(2,3)4/h12,14,17-19,21,25H,13,15-16H2,1-11H3/b14-12+/t17-,18+,19?,21-/m0/s1 |
| InChIKey | VMCVXCDLLSRTOP-MGXOWBGXSA-N |
| XLogP | 5.35 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.71 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|