C21H40O6Si — CID 174031479
ethyl (Z,6R)-6-[(2R,3R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate (PubChem CID 174031479) has the molecular formula C21H40O6Si and a molecular weight of 416.63 g/mol. Its IUPAC name is ethyl (Z,6R)-6-[(2R,3R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate.
| Compound Name | ethyl (Z,6R)-6-[(2R,3R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate |
|---|---|
| PubChem CID | 174031479 |
| Molecular Formula | C21H40O6Si |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | ethyl (Z,6R)-6-[(2R,3R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-6-methyloxan-2-yl]oxyhept-2-enoate |
| SMILES | CCOC(=O)/C=C\CC[C@@H](C)O[C@@H]1O[C@@H](C)C(O[Si](C)(C)C(C)(C)C)C[C@H]1O |
| InChI | InChI=1S/C21H40O6Si/c1-9-24-19(23)13-11-10-12-15(2)25-20-17(22)14-18(16(3)26-20)27-28(7,8)21(4,5)6/h11,13,15-18,20,22H,9-10,12,14H2,1-8H3/b13-11-/t15-,16+,17-,18?,20-/m1/s1 |
| InChIKey | MAHGGWPPPDZMIK-VMFNTLKCSA-N |
| XLogP | 4.18 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|