C26H16B11N5O3 — CID 174031818
CID 174031818 (PubChem CID 174031818) has the molecular formula C26H16B11N5O3 and a molecular weight of 565.38 g/mol.
| Compound Name | CID 174031818 |
|---|---|
| PubChem CID | 174031818 |
| Molecular Formula | C26H16B11N5O3 |
| Molecular Weight | 565.38 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | — |
| SMILES | [B]C1([B])C([B])([B])C([B])([B])C([B])(c2ccc(-c3cc(=O)n4[nH]c(-c5nccnc5C)c(C(=O)OCC)c4n3)cc2)C([B])([B])C1([B])[B] |
| InChI | InChI=1S/C26H16B11N5O3/c1-3-45-20(44)16-18(17-11(2)38-8-9-39-17)41-42-15(43)10-14(40-19(16)42)12-4-6-13(7-5-12)21(27)22(28,29)24(32,33)26(36,37)25(34,35)23(21,30)31/h4-10,41H,3H2,1-2H3 |
| InChIKey | HAUKQWYUALDJKX-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.38 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|