C36H48ClNO5 — CID 174033044
methyl 2-[7-chloro-14-[[(1R,2R,4R)-2-[(1S)-1-hydroxyprop-2-enyl]-4-methylcyclobutyl]methyl]-2-oxa-14-azatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaen-17-yl]-2-hydroxynon-8-enoate (PubChem CID 174033044) has the molecular formula C36H48ClNO5 and a molecular weight of 610.24 g/mol. Its IUPAC name is methyl 2-[7-chloro-14-[[(1R,2R,4R)-2-[(1S)-1-hydroxyprop-2-enyl]-4-methylcyclobutyl]methyl]-2-oxa-14-azatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaen-17-yl]-2-hydroxynon-8-enoate.
| Compound Name | methyl 2-[7-chloro-14-[[(1R,2R,4R)-2-[(1S)-1-hydroxyprop-2-enyl]-4-methylcyclobutyl]methyl]-2-oxa-14-azatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaen-17-yl]-2-hydroxynon-8-enoate |
|---|---|
| PubChem CID | 174033044 |
| Molecular Formula | C36H48ClNO5 |
| Molecular Weight | 610.24 g/mol |
| Exact Mass | 609.32 |
| IUPAC Name | methyl 2-[7-chloro-14-[[(1R,2R,4R)-2-[(1S)-1-hydroxyprop-2-enyl]-4-methylcyclobutyl]methyl]-2-oxa-14-azatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaen-17-yl]-2-hydroxynon-8-enoate |
| SMILES | C=CCCCCCC(O)(C(=O)OC)c1ccc2c(c1)N(C[C@H]1[C@H]([C@@H](O)C=C)C[C@H]1C)CCCCc1cc(Cl)ccc1CO2 |
| InChI | InChI=1S/C36H48ClNO5/c1-5-7-8-9-11-18-36(41,35(40)42-4)28-15-17-34-32(22-28)38(23-31-25(3)20-30(31)33(39)6-2)19-12-10-13-26-21-29(37)16-14-27(26)24-43-34/h5-6,14-17,21-22,25,30-31,33,39,41H,1-2,7-13,18-20,23-24H2,3-4H3/t25-,30-,31-,33+,36?/m1/s1 |
| InChIKey | TYTDENNRWGYLNU-USTXIICCSA-N |
| XLogP | 7.38 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.24 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|