C24H21N3 — CID 174036081
3-ethenyl-2-(ethylideneamino)-N,N-diphenyl-1H-indol-5-amine (PubChem CID 174036081) has the molecular formula C24H21N3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 3-ethenyl-2-(ethylideneamino)-N,N-diphenyl-1H-indol-5-amine.
| Compound Name | 3-ethenyl-2-(ethylideneamino)-N,N-diphenyl-1H-indol-5-amine |
|---|---|
| PubChem CID | 174036081 |
| Molecular Formula | C24H21N3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 3-ethenyl-2-(ethylideneamino)-N,N-diphenyl-1H-indol-5-amine |
| SMILES | C=Cc1c(N=CC)[nH]c2ccc(N(c3ccccc3)c3ccccc3)cc12 |
| InChI | InChI=1S/C24H21N3/c1-3-21-22-17-20(15-16-23(22)26-24(21)25-4-2)27(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h3-17,26H,1H2,2H3 |
| InChIKey | OUMDWILQMZDTGE-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 31.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|