C15H21N5OSi — CID 174037487
trimethyl-[2-(1-methyl-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-6-yl)ethynyl]silane (PubChem CID 174037487) has the molecular formula C15H21N5OSi and a molecular weight of 315.45 g/mol. Its IUPAC name is trimethyl-[2-(1-methyl-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-6-yl)ethynyl]silane.
| Compound Name | trimethyl-[2-(1-methyl-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-6-yl)ethynyl]silane |
|---|---|
| PubChem CID | 174037487 |
| Molecular Formula | C15H21N5OSi |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | trimethyl-[2-(1-methyl-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-6-yl)ethynyl]silane |
| SMILES | Cn1ncc2c(N3CCOCC3)nc(C#C[Si](C)(C)C)nc21 |
| InChI | InChI=1S/C15H21N5OSi/c1-19-14-12(11-16-19)15(20-6-8-21-9-7-20)18-13(17-14)5-10-22(2,3)4/h11H,6-9H2,1-4H3 |
| InChIKey | OPQKCNHLUYQGIT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|